Acids, Bases and Salts Review Flashcards

0.0(0)
Studied by 0 people
call kaiCall Kai
Locked
learnLearn
examPractice Test
spaced repetitionSpaced Repetition
heart puzzleMatch
flashcardsFlashcards
GameKnowt Play
Card Sorting

1/29

flashcard set

Earn XP

Description and Tags

Comprehensive flashcards generated from the complete lecture transcript on Acids, Bases, and Salts, including chemical properties, reactions, pH applications, and salt preparations.

Last updated 12:18 PM on 8/24/26
Name
Mastery
Learn
Test
Matching
Spaced
Call with Kai
Chat

No analytics yet

Send a link to your students to track their progress

30 Terms

1
New cards

What are the primary general properties of acids?

Acids are sour in taste, turn blue litmus red, and dissolve in water to release H+H^+ ions.

2
New cards
3
New cards

What are mineral acids and what are some examples of them?

Mineral acids are derived from inorganic compounds, mostly have a non-biological origin, dissolve well in water, and are mostly strong acids. Examples include HNO3HNO_3 and H2SO4H_2SO_4.

4
New cards

What are organic acids and what are some examples of them?

Organic acids are derived from organic compounds, mostly have a biological origin, dissolve poorly in water, and are mostly weak acids. Examples include Citric acid and Vinegar.

5
New cards

How do strong acids and weak acids differ in terms of dissociation?

Strong acids completely dissociate into their ions in water (e.g., HClHCl, H2SO4H_2SO_4, HNO3HNO_3), whereas weak acids partially dissociate into their ions in an aqueous solution or water (e.g., Acetic acid, Citric acid).

6
New cards

Which specific acids are found in vinegar, lemons/oranges, and tamarind/grapes?

Vinegar contains Acetic acid; lemons and oranges contain Citric acid; tamarind and grapes contain Tartaric acid.

7
New cards

Which acids are found in milk/yoghurt, apples/pears, and ant stings?

Milk and yoghurt contain Lactic acid; apples and pears contain Malic acid; ant stings contain Formic acid.

8
New cards

What acid is found in all citrus fruits?

Ascorbic acid (Vitamin C).

9
New cards

What products are formed when an acid reacts with a metal?

A metal salt and hydrogen gas (Acid+MetalSalt+H2\text{Acid} + \text{Metal} \rightarrow \text{Salt} + H_2 gas, e.g., 2HCl+ZnZnCl2+H22HCl + Zn \rightarrow ZnCl_2 + H_2).

10
New cards

What products are formed when an acid reacts with a metal carbonate?

A salt, carbon dioxide, and water (Acid+Metal carbonateSalt+CO2+H2O\text{Acid} + \text{Metal carbonate} \rightarrow \text{Salt} + CO_2 + H_2O, e.g., 2HCl+Na2CO32NaCl+CO2+H2O2HCl + Na_2CO_3 \rightarrow 2NaCl + CO_2 + H_2O).

11
New cards

What products are formed when an acid reacts with a metal hydrogen carbonate?

A salt, carbon dioxide, and water (Acid+Metal hydrogen carbonateSalt+CO2+H2O\text{Acid} + \text{Metal hydrogen carbonate} \rightarrow \text{Salt} + CO_2 + H_2O, e.g., HCl+NaHCO3NaCl+H2O+CO2HCl + NaHCO_3 \rightarrow NaCl + H_2O + CO_2).

12
New cards

What reaction occurs when an acid reacts with a metallic oxide?

They form a salt and water (Acid+Metal oxideSalt+Water\text{Acid} + \text{Metal oxide} \rightarrow \text{Salt} + \text{Water}, e.g., 2HCl+CuOCuCl2+H2O2HCl + CuO \rightarrow CuCl_2 + H_2O).

13
New cards

How do you test for the presence of H2H_2 gas and CO2CO_2 gas?

H2H_2 gas gives a popping sound when a flame is brought near it. CO2CO_2 gas turns lime water milky (Ca(OH)2+CO2CaCO3+H2OCa(OH)_2 + CO_2 \rightarrow CaCO_3 + H_2O).

14
New cards

Why can H+H^+ ions not exist alone in water, and what do they form?

H+H^+ ions combine with water molecules (H2OH_2O) to form hydronium ions (H3O+H_3O^+).

15
New cards

Why must acid be added dropwise into water with constant stirring during dilution?

Dissolving acid in water is a highly exothermic reaction. Adding water to concentrated acid can cause the mixture to heat up, splash out, and cause burns; adding acid dropwise to water allows the generated heat to spread.

16
New cards

What is the definition of a base, and what is an alkali?

Bases are bitter in taste, turn red litmus to blue, and release OHOH^- ions when dissolved in water. Bases that are soluble in water are called alkalis.

17
New cards

What reaction occurs between a base and a metal, and with which metals is it possible?

Base+MetalSalt+H2\text{Base} + \text{Metal} \rightarrow \text{Salt} + H_2 gas (e.g., 2NaOH+ZnNa2ZnO2+H22NaOH + Zn \rightarrow Na_2ZnO_2 + H_2). This reaction is possible only with reactive metals like sodium and potassium.

18
New cards

What are olfactory indicators, natural indicators, and synthetic indicators?

Olfactory indicators change odour in acidic or basic media (e.g., clove, vanilla, onion). Natural indicators include turmeric and litmus (obtained from lichen). Synthetic indicators include methyl orange and phenolphthalein.

19
New cards

What does 'p' in pH stand for, and what are the ranges on the pH scale?

The 'p' stands for 'potenz', a German word meaning power. On the pH scale, 11 to 66 is acidic, 77 is neutral, and 88 to 1414 is basic.

20
New cards

What pH levels define acid rain and the onset of tooth decay?

Acid rain occurs when the pH of rain water is less than 5.65.6. Tooth decay begins below a pH of 5.65.6.

21
New cards

What is the normal functioning pH range of the human body?

The human body functions within a pH range of 7.07.0 to 7.87.8.

22
New cards

What acid is present in a bee sting or nettle sting, and how is it neutralized?

They contain methanoic acid, which causes pain and irritation. It can be neutralized using a weak base like baking soda.

23
New cards

How is Sodium Hydroxide (NaOHNaOH) prepared, and what is the reaction equation?

It is prepared by the chlor-alkali process by electrolyzing brine: 2NaCl_{(aq)} + 2H_2O_{(l)} \rightarrow 2NaOH_{(aq)} + Cl_2_{(g)} + H_2_{(g)}.

24
New cards

How is Bleaching Powder (CaOCl2CaOCl_2) prepared?

It is prepared by reacting slaked lime with chlorine gas: Ca(OH)2+Cl2CaOCl2+H2OCa(OH)_2 + Cl_2 \rightarrow CaOCl_2 + H_2O.

25
New cards

What are the primary uses of Bleaching Powder?

  1. Bleaching cotton and linen in textile industries, and wood pulp in paper industry. 2. Disinfectant for water. 3. Used as an oxidising agent.
26
New cards

What is the chemical formula, common name, and preparation equation of Baking Soda?

Chemical formula: NaHCO3NaHCO_3; Common name: Baking Soda. Preparation: NaCl+H2O+CO2+NH3NH4Cl+NaHCO3NaCl + H_2O + CO_2 + NH_3 \rightarrow NH_4Cl + NaHCO_3.

27
New cards

What chemical reaction occurs when Baking Soda (NaHCO3NaHCO_3) is heated?

It decomposes to form sodium carbonate, water, and carbon dioxide: 2NaHCO3Na2CO3+H2O+CO22NaHCO_3 \rightarrow Na_2CO_3 + H_2O + CO_2.

28
New cards

What is the formula and preparation method for Washing Soda?

Formula: Na2CO3×10H2ONa_2CO_3 \times 10H_2O. It is prepared by the recrystallisation of sodium carbonate: Na2CO3+10H2ONa2CO3×10H2ONa_2CO_3 + 10H_2O \rightarrow Na_2CO_3 \times 10H_2O.

29
New cards

What is water of crystallization, and what are three standard examples?

It is the fixed number of water molecules present in one formula unit of a salt. Examples: CuSO4×5H2OCuSO_4 \times 5H_2O, FeSO4×7H2OFeSO_4 \times 7H_2O, and CaSO4×2H2OCaSO_4 \times 2H_2O.

30
New cards

How is Plaster of Paris prepared, and what is its chemical formula?

Plaster of Paris (CaSO4×12H2OCaSO_4 \times \frac{1}{2}H_2O) is prepared by heating gypsum (CaSO4×2H2OCaSO_4 \times 2H_2O) at 373 K373\text{ K}: CaSO4×2H2OCaSO4×12H2O+32H2OCaSO_4 \times 2H_2O \rightarrow CaSO_4 \times \frac{1}{2}H_2O + \frac{3}{2}H_2O.