Chapter 23: The Urinary System Study Guide

0.0(0)
Studied by 0 people
call kaiCall Kai
Locked
learnLearn
examPractice Test
spaced repetitionSpaced Repetition
heart puzzleMatch
flashcardsFlashcards
GameKnowt Play
Card Sorting

1/31

flashcard set

Earn XP

Description and Tags

Comprehensive flashcards covering the anatomy, physiology, and pathology of the urinary system based on the provided study guide.

Last updated 1:41 AM on 7/15/26
Name
Mastery
Learn
Test
Matching
Spaced
Call with Kai
Chat

No analytics yet

Send a link to your students to track their progress

32 Terms

1
New cards

What are the six principal organs that make up the urinary system?

Two kidneys, two ureters, one urinary bladder, and one urethra.

2
New cards

How do male and female urinary tracts differ in terms of the urethra?

The male urethra is approximately 20cm20\,cm long, serves both urinary and reproductive functions, and passes through the prostate. The female urethra is approximately 4cm4\,cm long, serves only urinary functions, and does not pass through a prostate.

3
New cards

Beyond waste excretion, what are four other functions performed by the kidneys?

Regulating blood volume and blood pressure, regulating plasma ion concentrations (Na+Na^+, K+K^+, Ca2+Ca^{2+}), maintaining blood pH, and secreting erythropoietin.

4
New cards

What is the difference between waste and metabolic waste?

Waste is any substance needing elimination, while metabolic waste specifically refers to byproducts of cellular metabolism, such as urea, creatinine, and uric acid.

5
New cards

Which organs and processes are responsible for producing urea and uric acid?

The liver converts ammonia (from amino acid breakdown) into urea; uric acid arises from the catabolism of nucleic acids.

6
New cards

What is the scientific name for an elevated Blood Urea Nitrogen (BUN) level?

Azotemia.

7
New cards

What is uremia and how is it treated?

Uremia is the accumulation of urea and waste in the blood due to severe kidney dysfunction; it is treated with dialysis or kidney transplantation.

8
New cards

Describe the anatomical location of the kidneys using the term retroperitoneal.

The kidneys are located in the abdominal cavity between T12L3T12-L3 vertebrae and are retroperitoneal, meaning they are posterior to the peritoneum.

9
New cards

What are the three protective coverings of the kidney?

The renal capsule (fibrous capsule), adipose capsule (perirenal fat), and renal fascia (outer layer).

10
New cards

What is nephroptosis?

The downward displacement of the kidney, also known as "floating kidney," which is more common in thin individuals.

11
New cards

Which two regions of the frontal section of the kidney make up the renal parenchyma?

The renal cortex and the renal medulla.

12
New cards

What structures merge to form a major calyx?

Two or three minor calyces merge to form a major calyx.

13
New cards

Trace the pathway of blood from the renal artery to the glomerular capillaries.

Renal artery \rightarrow segmental arteries \rightarrow interlobar arteries \rightarrow arcuate arteries \rightarrow interlobular arteries \rightarrow afferent arterioles \rightarrow glomerular capillaries.

14
New cards

What blood vessels give rise to the peritubular capillaries and the vasa recta?

Efferent arterioles give rise to peritubular capillaries in cortical nephrons and vasa recta in juxtamedullary nephrons.

15
New cards

What are the two principal parts of a nephron?

The renal corpuscle (filters blood plasma) and the renal tubule (converts filtrate into urine).

16
New cards

What are the four regions of the renal tubule?

Proximal convoluted tubule (PCT), nephron loop (loop of Henle), distal convoluted tubule (DCT), and collecting duct.

17
New cards

Provide the complete flow of fluid from the glomerular capsule to the urethra.

Glomerular capsule \rightarrow PCT \rightarrow nephron loop \rightarrow DCT \rightarrow collecting duct \rightarrow papillary duct \rightarrow minor calyx \rightarrow major calyx \rightarrow renal pelvis \rightarrow ureter \rightarrow urinary bladder \rightarrow urethra.

18
New cards

What are the three barriers of the filtration membrane in the renal corpuscle?

  1. Fenestrated endothelium of glomerular capillaries, 2. Basement membrane, 3. Podocytes with filtration slits.
19
New cards

How is Net Filtration Pressure (NFP) calculated?

NFP=BHP(CHP+BCOP)=55(15+30)=10mmHgNFP = BHP - (CHP + BCOP) = 55 - (15 + 30) = 10\,mmHg

20
New cards

What is the average amount of filtrate formed in 24 hours for males and females?

Males: approximately 180liters/day180\,liters/day; Females: approximately 150liters/day150\,liters/day.

21
New cards

How does the myogenic mechanism respond to increased arterial blood pressure?

The afferent arteriole constricts to reduce blood flow and maintain stable GFR.

22
New cards

What cell type releases renin and what is the stimulus?

Granular cells (juxtaglomerular cells) release renin in response to decreased blood pressure, decreased blood volume, or decreased sodium delivery.

23
New cards

What is the role of Angiotensin-Converting Enzyme (ACE) in the RAAS?

ACE, found in the lungs, converts angiotensin 1 into angiotensin 2.

24
New cards

What is solvent drag in the context of tubular reabsorption?

The process where solutes are carried along with water as it moves through the paracellular route.

25
New cards

What is transport maximum (TmT_m)?

The maximum rate of reabsorption; when exceeded, the substance (e.g., glucose) appears in the urine.

26
New cards

How does the permeability of the descending limb of the nephron loop differ from the ascending limb?

The descending limb is permeable to water but impermeable to salt; the ascending limb is permeable to salt but impermeable to water.

27
New cards

What pigment is responsible for the yellow color of urine and what is its origin?

Urochrome, which is produced from the breakdown of hemoglobin.

28
New cards

What are the ranges for urine specific gravity and pH?

Specific gravity: 1.0011.001 to 1.0351.035; pH range: 4.54.5 to 8.08.0 (average 6.06.0).

29
New cards

Distinguish between diabetes mellitus and diabetes insipidus.

Diabetes mellitus is caused by insulin deficiency/resistance leading to glycosuria; diabetes insipidus is caused by ADH deficiency/resistance leading to dilute urine.

30
New cards

What are the three layers of the urinary bladder wall?

Outermost to innermost: 1. Adventitia/serosa, 2. Muscularis (detrusor muscle), 3. Mucosa (transitional epithelium).

31
New cards

What is the trigone?

A triangular region in the bladder formed by the openings of the two ureters and the internal urethral orifice.

32
New cards

How does the autonomic nervous system control the detrusor muscle and internal urethral sphincter during micturition?

Parasympathetic nerves contract the detrusor muscle and relax the internal urethral sphincter to promote urination.