Comprehensive Study Notes on the Chemistry of Hydrogen and Hydrides

Fundamental Properties and Universal Occurrence of Hydrogen

Hydrogen is recognized as the first element in the periodic table and holds the distinction of being the lightest and most abundant element in the entire universe. It possesses an atomic number of 11 and carries a simple electronic configuration denoted as 1s11s^1. Because it possesses only a single electron, hydrogen is considered a unique element that exhibits chemical similarities with both the Group 1 alkali metals and the Group 7 halogens. In nature, hydrogen occurs primarily in two forms: the combined form within various chemical compounds and the free or elemental state (H2H_2) under specific conditions.

Hydrogen is widely distributed across the atmosphere, hydrosphere, lithosphere, and within living organisms. Within the vastness of interstellar space, it exists as atomic hydrogen (HH), ionized hydrogen (H+H^+), and molecular hydrogen (H2H_2). In stars, hydrogen exists as a plasma, which is a state of ionized gas, and serves as the primary fuel for stars through its participation in nuclear fusion processes. Despite its overwhelming abundance in the universe, it is not abundant in its free form on Earth. This scarcity is attributed to its low density and mass, which allow it to easily escape the Earth's gravitational field, as well as its high reactivity.

Distribution of Hydrogen in the Earth's Spheres

In the Earth's atmosphere, hydrogen is present mainly as molecular hydrogen (H2H_2), but only in trace amounts, specifically constituting approximately 0.00005%0.00005\% of the air by volume. This low concentration is due to its propensity to react with oxygen to form water vapor, its low molecular weight which facilitates escape into outer space, and its consumption by various atmospheric reactions and microorganisms.

The largest natural reservoir of hydrogen on Earth is water, found in oceans, rivers, lakes, and groundwater. Given that water covers approximately 71%71\% of the Earth's surface, hydrogen is extremely abundant within the hydrosphere. Within the Earth's crust (lithosphere), hydrogen is primarily located in minerals as hydroxides, within hydrocarbons, and in hydrated compounds, acids, and alkalis. Its high reactivity means it is rarely found in a free state; it readily combines with oxygen, halogens, sulfur, and nitrogen. It also forms strong bonds with carbon (CHC-H) and oxygen (OHO-H), which are integral to the formation of hydrocarbons and other stable molecules.

Biological and Geothermal Presence of Hydrogen

Hydrogen is a fundamental component of living organisms, appearing abundantly in biomolecules such as carbohydrates, proteins, fats, oils, nucleic acids (DNA and RNA), hormones, vitamins, and enzymes. It is essential for biological metabolism. Hydrogen bonding is particularly critical in biology, as it provides the necessary stabilization for structures like the DNA double helix and the folding patterns of proteins.

Beyond biological structures, certain microorganisms, including specific bacteria and algae, produce hydrogen gas as a by-product during anaerobic fermentation processes. Geologically, hydrogen is found in gases released from geothermal vents, hot springs, and volcanic eruptions. In modern technology, the storage of hydrogen in metal hydrides represents a significant area of research for hydrogen fuel applications.

The Isotopes of Hydrogen

Isotopes are defined as atoms of the same element that share the same atomic number (number of protons) but possess different mass numbers due to a differing number of neutrons. While isotopes share nearly identical chemical properties, their physical properties vary based on their mass. Hydrogen occurs naturally as three distinct isotopes: Protium, Deuterium, and Tritium. All three possess one proton and one electron.

Protium (1H^{1}H) is the most common isotope, making up approximately 99.985%99.985\% of natural hydrogen. It forms normal hydrogen gas (H2H_2) and is the most reactive form because of its high abundance. It is the primary isotope found in water and organic compounds and is essential for fuel production and combustion.

Deuterium (2H^{2}H or DD), known as "heavy hydrogen," has one proton and one neutron. It comprises about 0.015%0.015\% of natural hydrogen and is found in small amounts in natural water. Deuterium is used to create heavy water (D2OD_2O), which serves as a moderator in nuclear reactors and is used extensively in Nuclear Magnetic Resonance (NMR) spectroscopy. Because it is twice as heavy as protium, reactions involving deuterium proceed more slowly, a phenomenon known as the isotope effect.

Tritium (3H^{3}H or TT) is a radioactive isotope containing one proton and two neutrons. It is found only in trace amounts naturally, formed by cosmic ray reactions in the atmosphere, and is produced artificially in nuclear reactors. It has a half-life of approximately 12.3years12.3\,years and undergoes beta decay to form helium-3 (3He^{3}He). Its applications include hydrogen bombs, radioactive tracers, and nuclear fusion research.

IsotopeSymbolProtonsNeutronsAbundance
Protium1H^{1}H10 99.985%~99.985\%
Deuterium2H^{2}H or DD11 0.015%~0.015\%
Tritium3H^{3}H or TT12Radioactive (trace)

Properties and Applications of Heavy Water (D2OD_2O)

Heavy water (D2OD_2O) is formed from deuterium and is slightly denser than normal water, with higher freezing and boiling points. It is typically prepared through the fractional distillation of liquid hydrogen or the electrolysis of water, where deuterium remains in the residue due to being less reactive than protium.

The comparison of physical properties between normal water (H2OH_2O) and heavy water (D2OD_2O) is as follows:

  • Molecular mass: H2O=18H_2O = 18, D2O=20D_2O = 20
  • Density: H2O=1.0g/cm3H_2O = 1.0\,g/cm^3, D2O=1.105g/cm3D_2O = 1.105\,g/cm^3
  • Boiling point: H2O=100CH_2O = 100\,^\circ C, D2O=101.4CD_2O = 101.4\,^\circ C
  • Freezing point: H2O=0CH_2O = 0\,^\circ C, D2O=3.8CD_2O = 3.8\,^\circ C

In nuclear reactors, D2OD_2O acts as a moderator to slow down neutrons and sustain chain reactions. In chemical research, deuterated compounds like deuterated chloroform (CDCl3CDCl_3) are used as solvents for NMR spectroscopy to determine chemical structures. Deuterium also serves as an isotopic tracer in studies of metabolism and reaction mechanisms.

Tritium Production, Decay, and Hazards

Tritium (3H^{3}H) is unstable and undergoes beta decay according to the following equation: 3H3He+β+νˉ^3H \rightarrow ^3He + \beta^- + \bar{\nu}

Natural production occurs in the upper atmosphere via the reaction of cosmic rays with nitrogen: 14N+n12C+3H^{14}N + n \rightarrow ^{12}C + ^3H

Artificial production involves bombarding lithium with neutrons in nuclear reactors: 6Li+n3H+4He^6Li + n \rightarrow ^3H + ^4He

Tritium is used in nuclear fusion reactions because it releases enormous energy and enhances the reactions in thermonuclear weapons (hydrogen bombs). It is also used in self-powered lighting devices, such as exit signs and wristwatches, because the emitted beta particles excite phosphor materials to create a glow. However, tritium is hazardous if inhaled or ingested, often entering the body as tritiated water (T2OT_2O). While its radiation is weak, it can damage internal organs.

Laboratory Preparation of Hydrogen Gas

Hydrogen usually exists as a diatomic molecule (H2H_2). In a laboratory setting, it is commonly prepared using the following methods:

  1. Reaction of Reactive Metals with Dilute Acids: Zinc (ZnZn), iron (FeFe), and magnesium (MgMg) are used. Hydrogen is collected via the downward displacement of water because it is only slightly soluble in water and is lighter than air. Metals like copper (CuCu) and silver (AgAg) do not react because they are below hydrogen in the reactivity series. Zn(s)+2HCl(aq)ZnCl2(aq)+H2(g)Zn(s) + 2HCl(aq) \rightarrow ZnCl_2(aq) + H_2(g)Zn(s)+H2SO4(aq)ZnSO4(aq)+H2(g)Zn(s) + H_2SO_4(aq) \rightarrow ZnSO_4(aq) + H_2(g)

  2. Reaction of Amphoteric Metals with Alkalis: Aluminium dissolves in sodium hydroxide solution due to its amphoteric nature to produce hydrogen gas. 2Al(s)+2NaOH(aq)+6H2O(l)2Na[Al(OH)4](aq)+3H2(g)2Al(s) + 2NaOH(aq) + 6H_2O(l) \rightarrow 2Na[Al(OH)_4](aq) + 3H_2(g)

  3. Reaction of Active Metals with Water: Highly reactive metals like sodium (NaNa) and potassium (KK) react violently with cold water. Magnesium (MgMg) reacts slowly with cold water but faster with hot water or steam. 2Na(s)+2H2O(l)2NaOH(aq)+H2(g)2Na(s) + 2H_2O(l) \rightarrow 2NaOH(aq) + H_2(g)Ca(s)+2H2O(l)Ca(OH)2(aq)+H2(g)Ca(s) + 2H_2O(l) \rightarrow Ca(OH)_2(aq) + H_2(g)

  4. Reaction of Metals with Steam: Certain metals react with steam to produce metal oxides and hydrogen gas. 3Fe(s)+4H2O(g)Fe3O4(s)+4H2(g)3Fe(s) + 4H_2O(g) \rightarrow Fe_3O_4(s) + 4H_2(g)Mg(s)+H2O(g)MgO(s)+H2(g)Mg(s) + H_2O(g) \rightarrow MgO(s) + H_2(g)

Industrial Preparation of Hydrogen

Large-scale industrial production is essential for various chemical sectors. The primary methods include:

Steam Reforming of Natural Gas: This is the most significant industrial method. It involves heating methane (CH4CH_4) with steam at temperatures between 700C700\,^\circ C and 1000C1000\,^\circ C over a nickel catalyst to produce syngas (CO+H2CO + H_2). CH4(g)+H2O(g)CO(g)+3H2(g)CH_4(g) + H_2O(g) \rightarrow CO(g) + 3H_2(g)

Water Gas Shift Reaction: To increase hydrogen yield, carbon monoxide from the reforming process is reacted with more steam to produce carbon dioxide and more hydrogen. CO(g)+H2O(g)CO2(g)+H2(g)CO(g) + H_2O(g) \rightarrow CO_2(g) + H_2(g) Following this, purification is achieved through Pressure Swing Adsorption (PSA) or chemical absorption using alkaline solutions to remove CO2CO_2.

Coal Gasification: Coke (carbon) reacts with steam at approximately 1000C1000\,^\circ C to form water gas, which is then subjected to the shift reaction. C(s)+H2O(g)CO(g)+H2(g)C(s) + H_2O(g) \rightarrow CO(g) + H_2(g)

Electrolysis of Water: Electric current is passed through acidified or alkaline water to decompose it. While it produces very pure hydrogen, the process is expensive due to high electricity requirements. Cathode: 2H+(aq)+2eH2(g)2H^+(aq) + 2e^- \rightarrow H_2(g) Anode: 2H2O(l)O2(g)+4H+(aq)+4e2H_2O(l) \rightarrow O_2(g) + 4H^+(aq) + 4e^- Overall: 2H2O(l)2H2(g)+O2(g)2H_2O(l) \rightarrow 2H_2(g) + O_2(g)

Petroleum Refining: Hydrogen is also a by-product of hydrocarbon cracking and reforming in oil refineries. This hydrogen is often reused in hydrodesulphurization to remove sulfur from fuels.

Chemical Reactions of Molecular Hydrogen

Hydrogen is relatively unreactive at room temperature but becomes highly reactive when heated or in the presence of catalysts. Key reactions include:

  1. Combustion: Hydrogen burns in oxygen with a pale blue flame to produce water. This reaction is highly exothermic and clean, making hydrogen a potential green fuel. 2H2(g)+O2(g)2H2O(l)2H_2(g) + O_2(g) \rightarrow 2H_2O(l)

  2. Reaction with Halogens: Hydrogen forms hydrogen halides (HXHX). The reaction is violent with fluorine (F2F_2) even in the dark, and explosive with chlorine (Cl2Cl_2) in sunlight. Bromine requires heating, and the reaction with iodine is reversible, requiring a catalyst or heat. H2+F22HFH_2 + F_2 \rightarrow 2HFH2+Cl2sunlight2HClH_2 + Cl_2 \xrightarrow{\text{sunlight}} 2HClH2+Br2Δ2HBrH_2 + Br_2 \xrightarrow{\Delta} 2HBrH2+I22HIH_2 + I_2 \rightleftharpoons 2HI

  3. Reduction of Metal Oxides: Hydrogen acts as a reducing agent at high temperatures, removing oxygen from metal oxides to produce pure metal and water. CuO(s)+H2(g)ΔCu(s)+H2O(g)CuO(s) + H_2(g) \xrightarrow{\Delta} Cu(s) + H_2O(g)Fe2O3(s)+3H2(g)Δ2Fe(s)+3H2O(g)Fe_2O_3(s) + 3H_2(g) \xrightarrow{\Delta} 2Fe(s) + 3H_2O(g)

  4. Hydrogenation of Hydrocarbons: Hydrogen adds across double bonds in the presence of a nickel catalyst. This is used industrially to convert unsaturated vegetable oils into saturated fats like margarine. C2H4+H2NiC2H6C_2H_4 + H_2 \xrightarrow{Ni} C_2H_6

  5. Methanol Synthesis: Hydrogen reacts with carbon monoxide over a Cu/ZnOCu/ZnO catalyst. CO+2H2CH3OHCO + 2H_2 \rightarrow CH_3OH

  6. Sabatier Reaction: Hydrogen reacts with carbon dioxide to produce methane, useful for synthetic fuel and life-support systems in space. CO2+4H2CH4+2H2OCO_2 + 4H_2 \rightarrow CH_4 + 2H_2O

  7. Haber Process: The industrial synthesis of ammonia (NH3NH_3) for fertilizers requires a temperature of 450C450\,^\circ C, a pressure of 200atm200\,atm, a finely divided iron catalyst, and promoters like K2OK_2O or Al2O3Al_2O_3. N2(g)+3H2(g)2NH3(g)N_2(g) + 3H_2(g) \rightleftharpoons 2NH_3(g)

  8. Reaction with Sulphur: This produces hydrogen sulphide (H2SH_2S), characterized by its rotten egg odor. H2(g)+S(s)ΔH2S(g)H_2(g) + S(s) \xrightarrow{\Delta} H_2S(g)

  9. Reducing Agent Limitations: While hydrogen is a strong reducing agent, it cannot reduce very stable oxides such as Al2O3Al_2O_3, MgOMgO, or CaOCaO because these metals have a stronger affinity for oxygen than hydrogen does.

Classification and Properties of Hydrides

A hydride is a binary compound of hydrogen and another element. Based on bonding, they are classified into three types:

Ionic (Saline) Hydrides: Formed with highly electropositive metals (Group 1 and Group 2, excluding BeBe and partially MgMg). Hydrogen exists as the hydride ion (HH^-). These are crystalline solids with high melting points and conduct electricity in a molten state. They react violently with water to form a base and hydrogen gas. NaH+H2ONaOH+H2NaH + H_2O \rightarrow NaOH + H_2CaH2+2H2OCa(OH)2+2H2CaH_2 + 2H_2O \rightarrow Ca(OH)_2 + 2H_2

Covalent (Molecular) Hydrides: Formed with non-metals and p-block elements (CH4CH_4, NH3NH_3, etc.). They are usually gases or liquids with low melting/boiling points. They are divided into:

  • Electron-precise: Normal covalent bonding (e.g., CH4CH_4).
  • Electron-deficient: Fewer electrons than required for normal bonds, forming multicenter bonds (e.g., diborane, B2H6B_2H_6, which has 3-center 2-electron bonds).
  • Electron-rich: Contain lone pairs on the central atom (e.g., NH3NH_3, H2OH_2O, HFHF).

Metallic (Interstitial) Hydrides: Formed by transition metals, lanthanides, and actinides. Hydrogen atoms occupy interstitial voids in the metal lattice. They are often non-stoichiometric (e.g., PdH0.6PdH_{0.6}). They have metallic appearances, conduct electricity, and are hard/brittle. They are used in hydrogen storage, fuel cells, and rechargeable Ni-MH batteries.

Periodic Trends in Hydrides

Across a period (e.g., Period 3): The nature of hydrides shifts from ionic to covalent. The basicity decreases while acidity increases: NaH (basic)MgH2AlH3SiH4PH3H2SHCl (acidic)NaH\text{ (basic)} \rightarrow MgH_2 \rightarrow AlH_3 \rightarrow SiH_4 \rightarrow PH_3 \rightarrow H_2S \rightarrow HCl\text{ (acidic)}.

Down a group: Bond strength decreases as the HEH-E bond becomes longer and weaker. Consequently, thermal stability decreases (H2O>H2S>H2Se>H2TeH_2O > H_2S > H_2Se > H_2Te) and reducing power increases. Acidity generally increases down the group, illustrated by the halogen hydrides: HF<HCl<HBr<HIHF < HCl < HBr < HI.

Complex Hydrides: These contain complex ions such as [AlH4][AlH_4]^- and [BH4][BH_4]^-. Lithium aluminium hydride (LiAlH4LiAlH_4) and sodium borohydride (NaBH4NaBH_4) are powerful reducing agents widely used in organic chemistry to reduce aldehydes and ketones to alcohols.