Weak Acid Equilibria and pH Calculations

Weak Acid Equilibria

When dealing with weak acid solutions, our goal is often to determine the pH. Unlike strong acids, weak acids do not fully dissociate in water; thus, they produce hydrogen ions (H+H^+) but remain in equilibrium with their undissociated form. This incomplete dissociation is quantified by the acid dissociation constant, KaK_a, which is essential for calculating the pH of these solutions.

To accurately determine the pH, we must solve the equilibrium equation for hydrogen ions (H+H^+). It's crucial to remember that equilibrium expressions require concentrations in molarity (mol/L) or partial pressures (atm). Before setting up an ICE chart and solving for equilibrium, ensure all values are converted to the correct units.

Calculating pH of a Weak Acid Solution

Let’s take a closer look at how to calculate the pH of a 1 M solution of acetic acid (CH<em>3COOHCH<em>3COOH), given that its K</em>a=1.8×105K</em>a = 1.8 \times 10^{-5}. Acetic acid is a classic example of a weak acid, commonly found in vinegar.

The equation representing the dissociation of acetic acid in water is:

CH<em>3COOH</em>(aq)+H<em>2O</em>(l)CH<em>3COO</em>(aq)+H<em>3O+</em>(aq)CH<em>3COOH</em>{(aq)} + H<em>2O</em>{(l)} \rightleftharpoons CH<em>3COO^-</em>{(aq)} + H<em>3O^+</em>{(aq)}

ICE Chart

The ICE (Initial, Change, Equilibrium) chart is a structured approach to solve equilibrium problems:

  • Initial: At the start, the concentration of acetic acid (CH3COOHCH_3COOH) is 1 M. Water, being a solvent, is excluded from the equilibrium expression.

  • Change: We introduce xx to represent the concentration of hydronium ions (H<em>3O+H<em>3O^+) formed as the acid dissociates. Consequently, the acetic acid concentration decreases by xx, while the concentrations of the acetate ion (CH</em>3COOCH</em>3COO^-) and hydronium ions (H3O+H_3O^+) increase by xx.

  • Equilibrium: At equilibrium, the concentration of acetic acid (CH<em>3COOHCH<em>3COOH) is 1.00x1.00 - x, while the concentrations of both acetate ions (CH</em>3COOCH</em>3COO^-) and hydronium ions (H3O+H_3O^+) are xx.

Equilibrium Expression

The acid dissociation constant, KaK_a, is mathematically expressed as:

K<em>a=[H</em>3O+][CH<em>3COO][CH</em>3COOH]K<em>a = \frac{[H</em>3O^+][CH<em>3COO^-]}{[CH</em>3COOH]}

Substituting the equilibrium values from the ICE chart, we get:

1.8×105=xx1.00x1.8 \times 10^{-5} = \frac{x \cdot x}{1.00 - x}

Small Number Approximation (SNA)

Since acetic acid is a weak acid, and its initial concentration is significantly larger than the KaK_a value, we can simplify the calculation. We assume that xx is negligible compared to the initial concentration (i.e., x << 1.00), thus 1.00x1.001.00 - x \approx 1.00. This simplification is known as the Small Number Approximation (SNA). The equation then becomes:

1.8×105=x21.8 \times 10^{-5} = x^2

x=1.8×1050.0042x = \sqrt{1.8 \times 10^{-5}} \approx 0.0042

Therefore, the concentration of hydronium ions (H3O+H_3O^+) is approximately 0.0042 M.

Calculating pH

The pH is calculated using the formula:

pH=log[H3O+]=log(0.0042)2.38pH = -\log[H_3O^+] = -\log(0.0042) \approx 2.38

This calculated pH of 2.38 confirms that the solution is acidic, as expected for a weak acid solution.

Working Backwards from pH to Find Initial Concentration

Now, let’s consider a scenario where we have 250 mL of acetic acid (HC<em>2H</em>3O<em>2HC<em>2H</em>3O<em>2) solution with a measured pH of 2.82. Our objective is to determine the initial mass of acetic acid placed in the flask, using the known K</em>aK</em>a value.

The dissociation equation remains:

HC<em>2H</em>3O<em>2(aq)+H</em>2O<em>(l)C</em>2H<em>3O</em>2+H<em>3O+</em>(aq)HC<em>2H</em>3O<em>{{2(aq)}} + H</em>2O<em>{(l)} \rightleftharpoons C</em>2H<em>3O</em>2^- + H<em>3O^+</em>{(aq)}

Given pH=2.82pH = 2.82, we first find the concentration of hydronium ions (H3O+H_3O^+):

pH=log[H3O+]pH = -\log[H_3O^+]

[H3O+]=10pH=102.821.51×103 M[H_3O^+] = 10^{-pH} = 10^{-2.82} \approx 1.51 \times 10^{-3} \text{ M}

ICE Chart

  • Initial: The initial concentration of acetic acid (HC<em>2H</em>3O<em>2HC<em>2H</em>3O<em>2) is unknown, denoted as xx. The initial concentrations of acetate ions (C</em>2H<em>3O</em>2C</em>2H<em>3O</em>2^-) and hydronium ions (H3O+H_3O^+) are both 0.

  • Change: At equilibrium, the concentration of hydronium ions (H<em>3O+H<em>3O^+) is 1.51×1031.51 \times 10^{-3} M. According to stoichiometry, for every mole of hydronium ions (H</em>3O+H</em>3O^+) formed, one mole of acetate ions (C<em>2H</em>3O2C<em>2H</em>3O_2^-) is also formed. Thus, the change in concentration for both ions is +1.51×103+1.51 \times 10^{-3}.

  • Equilibrium: The equilibrium concentrations of hydronium ions (H<em>3O+H<em>3O^+) and acetate ions (C</em>2H<em>3O</em>2C</em>2H<em>3O</em>2^-) are 1.51×1031.51 \times 10^{-3} M. The acetic acid concentration decreases by the same amount, resulting in an equilibrium concentration of x1.51×103x - 1.51 \times 10^{-3}.

Equilibrium Expression

The equilibrium expression is:

K<em>a=[H</em>3O+][C<em>2H</em>3O<em>2][HC</em>2H<em>3O</em>2]K<em>a = \frac{[H</em>3O^+][C<em>2H</em>3O<em>2^-]}{[HC</em>2H<em>3O</em>2]}

Substituting the values:

1.8×105=(1.51×103)2x1.51×1031.8 \times 10^{-5} = \frac{(1.51 \times 10^{-3})^2}{x - 1.51 \times 10^{-3}}

Small Number Approximation

We apply the SNA, assuming x >> 1.51 \times 10^{-3}, simplifying the expression to x1.51×103xx - 1.51 \times 10^{-3} \approx x:

1.8×105=(1.51×103)2x1.8 \times 10^{-5} = \frac{(1.51 \times 10^{-3})^2}{x}

x=(1.51×103)21.8×1050.127 Mx = \frac{(1.51 \times 10^{-3})^2}{1.8 \times 10^{-5}} \approx 0.127 \text{ M}

Thus, the initial concentration of acetic acid is approximately 0.127 M.

Calculating Grams of Acetic Acid

With 250 mL (0.250 L) of solution, we calculate the number of moles of acetic acid:

0.250 L×0.127molesL0.03175 moles0.250 \text{ L} \times 0.127 \frac{\text{moles}}{\text{L}} \approx 0.03175 \text{ moles}

The molar mass of acetic acid (HC<em>2H</em>3O2HC<em>2H</em>3O_2) is approximately 60 g/mol. Therefore, the mass of acetic acid is:

0.03175 moles×60gmole1.91 grams0.03175 \text{ moles} \times 60 \frac{\text{g}}{\text{mole}} \approx 1.91 \text{ grams}

Thus, there are approximately 1.91 grams of acetic acid in the flask.

In summary, if you're given the concentration of the acid, you can find the pH. If you're given the pH, you can work backwards to find the initial concentration of the acid.

Identifying Weak Acid Equilibrium Problems: Key Indicators
  1. Presence of K<em>aK<em>a Value: The problem explicitly provides a K</em>aK</em>a value for the acid. This is a clear indicator that you're dealing with a weak acid, as strong acids are assumed to dissociate completely (and thus do not have a KaK_a value listed).

  2. Incomplete Dissociation: The problem states or implies that the acid does not completely dissociate in water. Phrases like "weak acid," "partially dissociates," or the presence of an equilibrium reaction ([\rightleftharpoons]) suggest incomplete dissociation.

  3. ICE Chart Applicability: The need to set up an ICE chart to determine equilibrium concentrations is a strong sign. Strong acids do not require ICE charts because their dissociation is complete and straightforward.

  4. **Small