Theme 4: Organic Chemistry and Analysis
TOPIC 4.1 FOUNDATIONS OF ORGANIC CHEMISTRY
Formula in Organic Chemistry
General Formula
Applied to chemicals in the same family
Alkanes, Cn H2n+2
Alkenes, Cn H2n
Alcohols, Cn H2n+1
Displayed Formula
All the atoms and all the bonds
Structural Formula
Arrangement of atoms in a molecule without showing all the bonds.
Infixes | Meaning |
-an- | all C-C |
-ene- | one C=C |
-yn- | one C≡C |
-dien- | two C=C |
-trien- | three C=C |
Condensed Formula
Each Carbon atom listed separately along with the other atoms it is attached to.
E.g. C6H14 can be expressed as CH3C(C2H6)CH(C2H5)CH2CH2CH2
Skeletal Formula
Only bond lines and functional groups are shown.
Homologous series: group of compounds that have the same functional group and general formula but different lengths of carbon chains.
Functional group: the reactive group attached to the physical and chemical properties of the compound in a specific homologous series.
Homologous series | Prefix or suffix | Example |
Alkanes | -ane | Butane |
Alkanes (branched) | alkyl- | Methyl-propane |
Cycloalkanes | cyclo- and -ane | Cyclopentane |
Alkenes | -ene | Propene |
Haloalkenes | fluoro-/chloro-/bromo-/iodo- and -alkane | Bromoethane |
Alcohols | -ol | Ethanol |
Aldehydes | -al | Propanal |
Ketones | -one | Propanone |
Carboxylic acids | -oic acid | Butanoic acid |
Esters | alkyl- and -anoate | Methyl ethanoate |
Amines | -amine | Propan-1-amine |
Basic rules for naming organic compounds
Find longest carbon chain
Decide suffix based on functional group
Decide prefix based on functional group and substituents
Functional group on lowest carbon number, number before suffix. Butan-1-ol.
Side chains written as prefixes in alphabetical order.
Identical functional groups get di-, tri-, tetra-, etc.
Bond fission
⟶Breaking of a covalent bond.
Heterolytic fission (heterolysis)
When a covalent bond is broken and the shared pair of electrons is taken by one species with the fewer electrons, to form a cation and an anion.
Homolytic fission
When a covalent bond is broken and the pair of electrons in the bond are shared equally to form two uncharged species, called radicals.
Free radicals
Atom with an unpaired valence electron
Very reactive intermediates
Combine with others to form new covalent bonds
Initiation
⟶Radicals are produced
⟶Visible normally or ultraviolet light
⟶Photochemical reaction; reaction started by the absorption of light.
Propagation
⟶When one radical reacts with a non-radical molecule.
⟶New radicals are created and react with other non-radicals (chain reaction)
Termination
⟶When two radicals react they form a non-radical molecule
⟶Ending chain reaction