EoT3 Coverage_10A 25-26 Revision_Unsolved

Introduction to Stoichiometry and Equation Interpretation

Stoichiometry is the study of quantitative relationships between the amounts of reactants used and the amounts of products formed by a chemical reaction. It is a fundamental concept in chemistry that allows scientists to predict the yields of reactions and determine the necessary amounts of starting materials. The word stems from Greek roots meaning "element" and "measure."

A balanced chemical equation is the foundation of stoichiometry. It can be interpreted in several ways: by individual particles, by moles, and by mass. For instance, in the reaction 4Fe(s)+3O2(g)2Fe2O3(s)4Fe(s) + 3O_2(g) \rightarrow 2Fe_2O_3(s), one can interpret this as 4 atoms of Iron reacting with 3 molecules of Oxygen to produce 2 formula units of Iron(III) oxide. Alternatively, in terms of moles, 4 moles of FeFe react with 3 moles of O2O_2 to produce 2 moles of Fe2O3Fe_2O_3. By calculating the mass, we see that 223.4g223.4\,g of FeFe and 96.00g96.00\,g of O2O_2 total to 319.4g319.4\,g of reactants, which equals the 319.4g319.4\,g of the product Fe2O3Fe_2O_3. This demonstrates the Law of Conservation of Mass, which states that total mass of reactants equals the total mass of products.

Stoichiometric Calculations and Flowchart Strategy

To solve stoichiometric problems, a specific multi-step procedure is typically followed. The first and most critical step is always writing and balancing the chemical equation for the reaction. The process then follows a flowchart logic based on the units provided and the units required for the final answer.

If the mass of a given substance is known (massgivenmass_{given}), the first step is to convert it into moles using the inverse of the molar mass (1molgrams\frac{1\,mol}{grams}). Once the moles of the given substance are determined (molesgivenmoles_{given}), a mole ratio derived from the balanced equation is used as a conversion factor to find the moles of the unknown substance (molesunknownmoles_{unknown}). The final step, if the answer must be in grams, is to convert these moles of the unknown into mass using its molar mass (grams1mol\frac{grams}{1\,mol}). If a problem starts with moles, Step 2 (mass-to-mole conversion) is skipped. If the answer is required in moles, Step 4 (mole-to-mass conversion) is skipped.

Examples of Stoichiometric Problems

One example provided involves the decomposition of ammonium nitrate: NH4NO3(s)N2O(g)+2H2O(g)NH_4NO_3(s) \rightarrow N_2O(g) + 2H_2O(g). To determine the mass of H2OH_2O produced from 25.0g25.0\,g of solid NH4NO3NH_4NO_3, we first determine the moles of reactant: 25.0gNH4NO3×1mol80.04g=0.312molNH4NO325.0\,g\,NH_4NO_3 \times \frac{1\,mol}{80.04\,g} = 0.312\,mol\,NH_4NO_3. Using the mole ratio of 2molH2O1molNH4NO3\frac{2\,mol\,H_2O}{1\,mol\,NH_4NO_3}, we find 0.624molH2O0.624\,mol\,H_2O. Finally, converting to mass: 0.624molH2O×18.02g1mol=11.2gH2O0.624\,mol\,H_2O \times \frac{18.02\,g}{1\,mol} = 11.2\,g\,H_2O.

Another case study involves methane and sulfur: CH4(g)+1S8(s)1CS2(l)+2H2S(g)CH_4(g) + 1S_8(s) \rightarrow 1CS_2(l) + 2H_2S(g). (Note: Balancing depends on specific products, here S8S_8 requires careful coefficients). In the challenge problem for Titanium extraction from Titanium Oxide (TiO2TiO_2) using Chlorine and Carbon: TiO2(s)+C(s)+2Cl2(g)TiCl4(s)+CO2(g)TiO_2(s) + C(s) + 2Cl_2(g) \rightarrow TiCl_4(s) + CO_2(g). To find the mass of Cl2Cl_2 needed for 1.25mol1.25\,mol of TiO2TiO_2, one uses the ratio 2molCl21molTiO2\frac{2\,mol\,Cl_2}{1\,mol\,TiO_2}, resulting in 2.50molCl22.50\,mol\,Cl_2. Multiplying by the molar mass (71g/mol71\,g/mol) gives 177.5gCl2177.5\,g\,Cl_2.

Limiting and Excess Reactants

Chemical reactions typically stop when one of the reactants is completely consumed. This reactant is known as the Limiting Reactant (LR), as it determines how much product can be produced. The reactants that remain after the reaction has stopped are called Excess Reactants. Identifying the limiting reactant is crucial because all stoichiometric calculations must be based on the amount of the limiting reactant, not the excess.

To identify the limiting reactant mathematically, one must convert the mass of all reactants to moles. Then, divide the number of moles of each reactant by its respective coefficient from the balanced chemical equation. The reactant with the smallest resulting number is the limiting reactant. For example, in the reaction N2+3H22NH3N_2 + 3H_2 \rightarrow 2NH_3, if we start with 5moles5\,moles of N2N_2 and 5moles5\,moles of H2H_2, we compare the ratios: N2:51=5N_2: \frac{5}{1} = 5 and H2:531.67H_2: \frac{5}{3} \approx 1.67. Since 1.67<51.67 < 5, Hydrogen is the limiting reactant and Nitrogen is in excess.

Theoretical, Actual, and Percent Yield

In chemical manufacturing and laboratory experiments, reactions rarely go to completion with 100% efficiency. The Theoretical Yield is the maximum amount of product that can be produced from a given amount of reactant according to stoichiometric calculations. The Actual Yield is the amount of product specifically measured and obtained from an experiment.

Several factors can reduce the yield: reactants may not all react, liquid reactants or products might evaporate, products may adhere to the surfaces of containers (like filter paper or beakers), or competing reactions may produce unintended byproducts. To measure efficiency, chemists calculate the Percent Yield using the formula: percent yield=actual yieldtheoretical yield×100\text{percent yield} = \frac{\text{actual yield}}{\text{theoretical yield}} \times 100.

The Kinetic-Molecular Theory and Gas Behavior

The Kinetic-Molecular Theory (KMT) explains the behavior of matter based on the motion of particles. It rests on five major assumptions regarding gases: (1) Gases consist of small particles separated by large amounts of empty space, meaning they experience no significant attractive or repulsive forces; (2) Gas particles are in constant, random motion; (3) Collisions between particles are elastic, meaning no kinetic energy is lost; (4) The size of gas particles is negligible compared to the volume of the container; (5) The average kinetic energy of gas particles depends only on temperature.

This theory explains why gases have low density compared to solids and liquids. For instance, Gold (AuAu) has a density of roughly 19.3g/mL19.3\,g/mL, whereas Chlorine gas (Cl2Cl_2) is only 2.95×103g/mL2.95 \times 10^{-3}\,g/mL. Gases can be compressed (volume decreases) and expanded (volume increases) easily because of the space between particles. Diffusion refers to the movement of one material through another, while effusion refers to gas escaping through a tiny opening.

Graham's Law and Dalton's Law

Graham's Law of Effusion states that the rate of effusion (or diffusion) for a gas is inversely proportional to the square root of its molar mass (MM). The formula is expressed as: RateARateB=MBMA\frac{\text{Rate}_A}{\text{Rate}_B} = \sqrt{\frac{M_B}{M_A}}. For example, if comparing Ammonia (NH3,17.0g/molNH_3, 17.0\,g/mol) and Hydrogen Chloride (HCl,36.5g/molHCl, 36.5\,g/mol), the ratio is 36.517.01.47\sqrt{\frac{36.5}{17.0}} \approx 1.47, meaning Ammonia diffuses 1.47 times faster than HClHCl.

Dalton's Law of Partial Pressures states that the total pressure of a mixture of gases is the sum of the pressures of all the individual gases in the mixture. Mathematically, it is: Ptotal=P1+P2+P3+...+PnP_{total} = P_1 + P_2 + P_3 + ... + P_n. This is used to find the partial pressure of a specific gas if the total and other individual pressures are known (PO2=PtotalPCO2PN2P_{O_2} = P_{total} - P_{CO_2} - P_{N_2}). Units for pressure can include atmospheres (1atm1\,atm), millimeters of mercury (760mmHg760\,mmHg), torr (760torr760\,torr), kilopascals (101.3kPa101.3\,kPa), pounds per square inch (14.7psi14.7\,psi), and bar (1.01bar1.01\,bar).

Basic Gas Laws: Boyle, Charles, and Gay-Lussac

Boyle's Law describes an inverse relationship between pressure and volume at a constant temperature: P1V1=P2V2P_1V_1 = P_2V_2. For example, an air bubble rising from 10m10\,m depth changes from 2.25atm2.25\,atm to 1.03atm1.03\,atm; its volume increases accordingly.

Charles's Law describes a direct relationship between volume and temperature at a constant pressure: V1T1=V2T2\frac{V_1}{T_1} = \frac{V_2}{T_2}. Temperature must always be converted to the Kelvin scale using the formula TK=273+TCT_K = 273 + T_C. Absolute zero (0K0\,K) represents the point at which gas volume would theoretically be zero.

Gay-Lussac's Law describes a direct relationship between pressure and temperature at a constant volume: P1T1=P2T2\frac{P_1}{T_1} = \frac{P_2}{T_2}. If the temperature of a gas canister at 5.00atm5.00\,atm and 25.0C25.0^\circ\text{C} (298K298\,K) drops to 10.0C-10.0^\circ\text{C} (263K263\,K), the pressure decreases: P2=5.00×263298=4.41atmP_2 = 5.00 \times \frac{263}{298} = 4.41\,atm.

Avogadro's Principle and the Ideal Gas Law

Avogadro's Principle states that equal volumes of gases at the same temperature and pressure contain equal numbers of particles. At Standard Temperature and Pressure (STP), defined as 0.00C0.00^\circ\text{C} and 1.00atm1.00\,atm, one mole of any gas occupies a Molar Volume of 22.4L22.4\,L. This provides a useful conversion factor (22.4L/mol22.4\,L/mol) at STP conditions.

The Ideal Gas Law combines these variables