Comprehensive Study Notes on Aldehydes and Ketones

Introduction to Carbonyl Compounds

Aldehydes and ketones belong to a class of organic compounds known as carbonyl compounds. The defining feature of these compounds is the carbonyl group, denoted as C=OC=O, which consists of a carbon atom double-bonded to an oxygen atom. This functional group is central to their chemical behavior and reactivity.

Aldehydes are characterized by a carbonyl carbon that is bonded to at least one hydrogen atom and one alkyl or aryl group. This configuration makes the carbonyl group terminal, usually represented by the general formula RCHOR-CHO. The simplest member of this series is methanal, commonly known as formaldehyde (HCHOHCHO).

Ketones, on the other hand, feature a carbonyl carbon that is bonded to two alkyl or aryl groups. This means the >C=O functional group is internal to the carbon chain, rather than at the end. The general formula for a ketone is RCORR-CO-R'. The simplest possible ketone is propanone, also known as acetone (CH3COCH3CH_3COCH_3).

Nomenclature of Aldehydes and Ketones

The IUPAC system provides a systematic way to name these compounds. For aldehydes, the final "-e" of the parent alkane is replaced with the suffix "-al." Because the aldehyde carbon is by definition part of the terminal functional group, it is always assigned position number 1, and therefore no locant number is required in the name. Examples include methanal (HCHOHCHO), ethanal (acetaldehyde, CH3CHOCH_3CHO), propanal (propionaldehyde, CH3CH2CHOCH_3CH_2CHO), and pentanal (CH3(CH2)3CHOCH_3(CH_2)_3CHO). For cyclic aldehydes, the suffix "-carbaldehyde" is appended to the name of the ring, such as in cyclohexanecarbaldehyde.

Ketones are named by replacing the "-e" of the parent alkane with the suffix "-one." To indicate the position of the internal carbonyl group, the carbon chain is numbered from the end that gives the carbonyl carbon the lowest possible locant. Examples include propan-2-one (acetone, CH3COCH3CH_3COCH_3), butan-2-one (CH3COCH2CH3CH_3COCH_2CH_3), pentan-3-one (CH3CH2COCH2CH3CH_3CH_2COCH_2CH_3), pentan-2-one (CH3COCH2CH2CH3CH_3COCH_2CH_2CH_3), heptan-2-one (CH3(CH2)4COCH3CH_3(CH_2)_4COCH_3), and octan-2-one (CH3(CH2)5COCH3CH_3(CH_2)_5COCH_3). An additional complex example mentioned is 4-ethyl-3-methyl-2-oxohept-3-one. The simplest ketone is propan-2-one.

Preparation of Aldehydes and Ketones

The oxidation of alcohols is the most common laboratory method for preparing these compounds. Primary (1o1^o) alcohols are oxidized to aldehydes. To prevent further oxidation to carboxylic acids, mild oxidizing agents such as PCC (Pyridinium Chlorochromate) must be used. Stronger agents like KMnO4KMnO_4 or K2Cr2O7K_2Cr_2O_7 will over-oxidize the product. The general reaction is RCH2OH+[O] (PCC)RCHO+H2OR-CH_2OH + [O] \text{ (PCC)} \rightarrow R-CHO + H_2O, with the conversion of ethanol to ethanal (CH3CH2OH+PCCCH3CHOCH_3CH_2OH + PCC \rightarrow CH_3CHO) serving as a specific example.

Secondary (2o2^o) alcohols are oxidized to ketones. This can be achieved using various oxidizing agents, including PCC, KMnO4KMnO_4, K2Cr2O7K_2Cr_2O_7, or H2CrO4H_2CrO_4. The general reaction is RCH(OH)R+[O]RCOR+H2OR-CH(OH)-R' + [O] \rightarrow R-CO-R' + H_2O. For instance, propan-2-ol can be oxidized to propanone (CH3CH(OH)CH3+[O]CH3COCH3CH_3CH(OH)CH_3 + [O] \rightarrow CH_3COCH_3).

Alcohol vapours can also undergo catalytic dehydrogenation. By passing the vapours over a heated copper catalyst, hydrogen is removed. Primary alcohols yield aldehydes (RCH2OHCu,heatRCHO+H2R-CH_2OH \xrightarrow{Cu, heat} R-CHO + H_2), while secondary alcohols yield ketones (RCH(OH)RCu,heatRCOR+H2R-CH(OH)-R' \xrightarrow{Cu, heat} R-CO-R' + H_2).

On an industrial scale, methanal is prepared by the air oxidation of methanol over a silver or molybdenum oxide catalyst at high temperatures: CH3OH+12O2Ag,heatHCHO+H2OCH_3OH + \frac{1}{2}O_2 \xrightarrow{Ag, heat} HCHO + H_2O. Similarly, ethanal is produced by the air oxidation of ethanol over a silver catalyst: CH3CH2OH+12O2Ag,heatCH3CHO+H2OCH_3CH_2OH + \frac{1}{2}O_2 \xrightarrow{Ag, heat} CH_3CHO + H_2O. Another industrial method is the Fischer-Tropsch Synthesis, which involves reacting carbon monoxide (COCO) and hydrogen (H2H_2) at high temperatures and pressures with a catalyst. This can produce methanal (CO+2H2catalystHCHOCO + 2H_2 \xrightarrow{catalyst} HCHO) or a complex mixture of alcohols, aldehydes, and ketones depending on the stoichiometry: nCO+(2n+1)H2catalystmixture of alcohols/aldehydes/ketonesnCO + (2n+1)H_2 \xrightarrow{catalyst} \text{mixture of alcohols/aldehydes/ketones}.

Aldehydes can also be specifically prepared by the reduction of acid chlorides (acyl halides) using the mild and selective reducing agent lithium tri-tert-butoxyaluminium hydride, LiAlH(OC(CH3)3)3LiAlH(OC(CH_3)_3)_3. This reagent is designed not to further reduce the resulting aldehyde into an alcohol. An example is the reduction of CH3CH2COClCH_3CH_2COCl to propanal (CH3CH2CHOCH_3CH_2CHO).

Physical Properties of Carbonyl Compounds

The solubility of aldehydes and ketones in water is limited to the lower members of the series (up to C4C_4). This solubility is due to the ability of the carbonyl oxygen to form hydrogen bonds with water molecules. As the hydrophobic alkyl chain increases in length, the overall solubility in water decreases.

In terms of boiling points, carbonyl compounds generally have higher boiling points than hydrocarbons of similar molecular mass because of dipole-dipole interactions. However, they have lower boiling points than their corresponding alcohols because the carbonyl compounds cannot form intermolecular hydrogen bonds with each other. These compounds also exhibit characteristic odors: lower members often have sharp, unpleasant smells, while higher members have pleasant, fruity scents. Benzaldehyde is a notable example, being the primary component of almond and vanilla flavors. Additionally, the lower members of these series are highly flammable.

Chemical Reactions and Relative Reactivity

Aldehydes are generally more reactive than ketones when it comes to nucleophilic addition reactions. This difference is attributed to two factors. First is the Electronic Effect: aldehydes have only one alkyl group donating electron density to the carbonyl carbon, leaving it more electrophilic (moreδ+more \delta+). Ketones have two alkyl groups that push electron density toward the carbon, reducing its positive character. Second is the Steric Effect: the carbonyl carbon in aldehydes is less hindered and more accessible because it is bonded to only one alkyl group and one small hydrogen atom, unlike ketones which have two bulkier alkyl groups.

The characteristic reaction for these compounds is nucleophilic addition, driven by the polar nature of the C=OC=O bond (CC is δ+\delta+ and OO is δ\delta-). One example is the addition of hydrogen cyanide (HCNHCN), generated in situ via sodium cyanide (NaCNNaCN) and dilute sulfuric acid (H2SO4H_2SO_4). This forms a cyanohydrin, which contains both OH-OH and CN-CN groups on the same carbon. For example, CH3CHO+HCNCH3CH(OH)CNCH_3CHO + HCN \rightarrow CH_3CH(OH)CN (acetaldehyde cyanohydrin). These cyanohydrins can be subsequently hydrolyzed to form α\alpha-hydroxy acids.

Grignard reagents (RMgXRMgX) also add to carbonyls to form alcohols. Formaldehyde (HCHOHCHO) reacts with a Grignard reagent to produce a primary (1o1^o) alcohol; other aldehydes produce secondary (2o2^o) alcohols; and ketones produce tertiary (3o3^o) alcohols. Furthermore, reduction with agents like LiAlH4LiAlH_4, NaBH4NaBH_4, or catalytic hydrogenation converts aldehydes to primary alcohols and ketones to secondary alcohols.

A specific reduction process called the Clemmensen Reduction uses zinc amalgam (Zn/HgZn/Hg) in concentrated hydrochloric acid (HClHCl) to reduce the carbonyl group (>C=O) entirely to a methylene group (CH2-CH_2-), converting the compound into an alkane. For example, butan-2-one can be reduced to butane: CH3COCH2CH3Zn(Hg)/HClCH3CH2CH2CH3CH_3COCH_2CH_3 \xrightarrow{Zn(Hg)/HCl} CH_3CH_2CH_2CH_3.

Condensation reactions with ammonia derivatives (H2NRH_2N-R) are useful for characterization. These involve addition followed by the elimination of water to form a >C=N- bond. Reaction with hydroxylamine (NH2OHNH_2OH) forms an oxime (>C=N-OH). Reaction with hydrazine (NH2NH2NH_2NH_2) forms a hydrazone (>C=N-NH_2). Reaction with phenylhydrazine (C6H5NHNH2C_6H_5NHNH_2) yields a phenylhydrazone (>C=N-NHC_6H_5). Finally, reaction with 2,4-Dinitrophenylhydrazine (2,4-DNPH, or Brady's Reagent) produces a distinct yellow or orange precipitate, serving as a general qualitative test for the presence of any carbonyl group.

Distinguishing Tests Between Aldehydes and Ketones

Tollen's Test (Silver Mirror Test) utilizes Tollen's reagent, a solution containing the complex ion [Ag(NH3)2]+[Ag(NH_3)_2]^+. Aldehydes are easily oxidized and will reduce the silver ions to metallic silver, which deposits on the test tube wall as a silver mirror: RCHO+2[Ag(NH3)2]++3OHRCOO+2Ag+4NH3+2H2OR-CHO + 2[Ag(NH_3)_2]^+ + 3OH^- \rightarrow R-COO^- + 2Ag \downarrow + 4NH_3 + 2H_2O. Ketones generally give a negative result, though α\alpha-hydroxy ketones like fructose can give a positive result due to tautomerization.

Fehling's Test uses Fehling's solution (a mixture of CuSO4CuSO_4 and sodium potassium tartrate in NaOHNaOH). Aliphatic aldehydes reduce blue Cu2+Cu^{2+} ions to a brick-red precipitate of copper(I) oxide (Cu2OCu_2O): RCHO+2Cu2++5OHRCOO+Cu2O+3H2OR-CHO + 2Cu^{2+} + 5OH^- \rightarrow R-COO^- + Cu_2O \downarrow + 3H_2O. Most ketones and aromatic aldehydes yield a negative result in this test.

The Iodoform Test is used to identify methyl ketones (CH3CORCH_3-CO-R) and certain alcohols (CH3CH(OH)CH_3-CH(OH)-). Using iodine in sodium hydroxide (I2/NaOHI_2/NaOH or NaOINaOI), these compounds are oxidized and halogenated to form a pale yellow precipitate of iodoform (CHI3CHI_3) with a characteristic antiseptic smell. Propanone and butan-2-one give positive results. While ethanal (CH3CHOCH_3CHO) technically has the required structure, it often fails or is unreliable due to competing aldol condensation. Pentan-3-one gives a negative result because it is not a methyl ketone.

Aromatic Carbonyl Compounds

In aromatic aldehydes and ketones, the carbonyl group is attached directly to a benzene ring; examples include benzaldehyde (C6H5CHOC_6H_5CHO) and acetophenone (C6H5COCH3C_6H_5COCH_3). The carbonyl group acts as a deactivating and meta-directing group for electrophilic aromatic substitution. For instance, the nitration of benzaldehyde with HNO3/H2SO4HNO_3/H_2SO_4 primarily yields m-nitrobenzaldehyde. Aromatic ketones are often prepared via Friedel-Crafts acylation, where benzene reacts with an acyl halide in the presence of a Lewis acid catalyst like AlCl3AlCl_3: C6H6+RCOClAlCl3C6H5COR+HClC_6H_6 + RCOCl \xrightarrow{AlCl_3} C_6H_5COR + HCl.