Reaction Enthalpy and Types of Reactions

Calculation of Reaction Enthalpy

Given Reaction

  • Reaction formula:
    5CO(g)+Si<em>3N</em>4(s)3SiO(s)+2N2O(g)+5CO(g)5CO(g) + Si<em>3N</em>4(s) \rightarrow 3SiO(s) + 2N_2O(g) + 5CO(g)

  • Required: Reaction enthalpy (ΔH\Delta H)

Provided Data

  • Equation 1: CO(g)+SiO(s)SiO(g)+CO2(g)CO(g) + SiO(s) \rightarrow SiO(g) + CO_2(g)

    • Enthalpy change:
      ΔH=+520.9kJ\Delta H = +520.9 \, kJ

  • Equation 2: 8CO(g)+Si<em>3N</em>4(s)3SiO<em>2(s)+2N</em>2O(g)+8CO(g)8CO(g) + Si<em>3N</em>4(s) \rightarrow 3SiO<em>2(s) + 2N</em>2O(g) + 8CO(g)

    • Enthalpy change:
      ΔH=+461.05kJ\Delta H = +461.05 \, kJ

Approach to Calculate Reaction Enthalpy

  • To calculate the enthalpy change for the target reaction, we can utilize Hess's law.

  • Hess's law states that the total enthalpy change during a chemical reaction is the sum of the enthalpy changes for each step of the reaction.

  • Rearranging the provided equations could help us find the enthalpy for the target reaction.

Modify Provided Equations
  1. For Equation 1:

    • Reverse the equation:
      SiO(g)+CO2(g)CO(g)+SiO(s)SiO(g) + CO_2(g) \rightarrow CO(g) + SiO(s)

    • Change the sign of enthalpy:
      ΔH=520.9kJ\Delta H = -520.9 \, kJ

  2. For Equation 2:

    • Use as is to help build the target reaction.

    • Avoid cancellations of CO(g).

Combination Steps
  • Write down the modified equations for combination:

    CO(g)+SiO(s)SiO(g)+CO2(g)<br>ΔH=520.9kJCO(g) + SiO(s) \rightarrow SiO(g) + CO_2(g)<br>\Delta H = -520.9 kJ

    8CO(g)+Si<em>3N</em>4(s)3SiO<em>2(s)+2N</em>2O(g)+8CO(g)<br>ΔH=+461.05kJ8CO(g) + Si<em>3N</em>4(s) \rightarrow 3SiO<em>2(s) + 2N</em>2O(g) + 8CO(g)<br>\Delta H = +461.05 kJ

  • Add both equations:

    • The initial CO terms cancel out. The result would indicate a new reaction:
      5CO(g)+Si<em>3N</em>4(s)3SiO(s)+2N<em>2O(g)+5CO(g)3SiO(s)+2N</em>2O(g)5CO(g) + Si<em>3N</em>4(s) \rightarrow 3SiO(s) + 2N<em>2O(g) + 5CO(g) \rightarrow 3SiO(s) + 2N</em>2O(g)

Final Calculation of Enthalpy
  • Calculate the total change in enthalpy:

    ΔH=520.9kJ+461.05kJ\Delta H = -520.9 \, kJ + 461.05 \, kJ

    • Perform calculation:
      ΔH=59.85kJ\Delta H = -59.85 \, kJ

Determine Exothermic or Endothermic

  • Since the calculated enthalpy change (( \Delta H = -59.85 \, kJ )) is negative, the reaction is exothermic.

Additional Problem: Reaction of Magnesium Oxide with Hydrogen Chloride

Reaction Overview
  • Examine the formation reaction:
    MgO(s)+2HCl(aq)MgCl<em>2(aq)+H</em>2O(l)MgO(s) + 2HCl(aq) \rightarrow MgCl<em>2(aq) + H</em>2O(l)

Expected Outcome
  • To find the enthalpy change for the magnesium oxide reaction with HCl, experimental values for enthalpy of formation or standard enthalpy changes related to the species in the reaction must be known.

Exothermic or Endothermic?
  • If the enthalpy change is calculated to be negative, the reaction is exothermic. Conversely, a positive result indicates an endothermic reaction.

  • For this specific case: Further experimental data is required to achieve the necessary enthalpy calculation.

  • Standard data can typically be referenced from a chemistry textbook or database for the specific enthalpy of formation for the involved species.