Principles of Thermochemistry and Calorimetry

Enthalpy and Reaction Energy

Heat of reaction is expressed as the change in enthalpy ΔH\Delta H of a system, calculated as ΔH=H(products)H(reactants)\Delta H = H(\text{products}) - H(\text{reactants}). This value is measured in kJ/molkJ/mol. A positive ΔH\Delta H indicates an endothermic process where energy is added, while a negative ΔH\Delta H indicates an exothermic process where energy is released.

Standard Heat of Formation

The standard heat of formation ΔHfθ\Delta H^\theta_f is the heat change occurring when one mole of a compound is formed from its constituent elements in their natural states at 25C25^\circ C and 1atm1\,atm. By definition, all elements in their standard states have an enthalpy of zero. The standard heat of reaction is determined using the formula:

 ΔHrxnθ=ΔHfθ(products)ΔHfθ(reactants)\Delta H^\theta_{rxn} = \sum \Delta H^\theta_f (\text{products}) - \sum \Delta H^\theta_f (\text{reactants})

In the thermite reaction Cr2O3(s)+2Al(s)2Cr(s)+Al2O3(s)Cr_2O_3 (s) + 2Al (s) \rightarrow 2Cr (s) + Al_2O_3 (s), weights are applied using ΔHfθ(Cr2O3)=1128.4kJmol1\Delta H^\theta_f (Cr_2O_3) = -1128.4\,kJ\,mol^{-1} and ΔHfθ(Al2O3)=1669.3kJmol1\Delta H^\theta_f (Al_2O_3) = -1669.3\,kJ\,mol^{-1}, resulting in a net ΔH\Delta H of 540.9kJmol1-540.9\,kJ\,mol^{-1}.

Heat of Combustion

Combustion reactions involve burning substances in oxygen to release energy, making them always exothermic. The standard heat of combustion ΔHcθ\Delta H^\theta_c is the heat released during the complete combustion of one mole of a fuel at standard pressure. For phosphorus, while the heat of formation for P4O10(s)P_4O_{10} (s) is 2984kJmol1-2984\,kJ\,mol^{-1}, the heat of combustion based on one mole of P(s)P (s) is 746kJmol1-746\,kJ\,mol^{-1}, as shown in the equation:

P(s)+54O2(g)14P4O10(s)P (s) + \frac{5}{4} O_2 (g) \rightarrow \frac{1}{4} P_4O_{10} (s)

Calorimetry and Measurement

Calorimetry measures the quantity of heat exchanged between a system and its surroundings. A bomb calorimeter is a specific constant-volume device used to measure the heat of combustion by igniting fuel and measuring the temperature change of surrounding water. The calorie is a metric unit of energy, where 1calorie1\,\text{calorie} equals the specific heat capacity of water, defined as 4.184JC1g14.184\,J\,^\circ C^{-1}\,g^{-1}.

Specific Heat Capacity and Thermal Calculations

Temperature indicates the average kinetic energy of particles, while heat energy represents the total energy within an object. Each substance has a specific heat capacity (CC), representing the energy required to raise the temperature of 1g1\,g of that substance by 1C1^\circ C. Energy calculations are performed using the relationship:

q=mCΔTq = mC\Delta T

Where qq is heat, mm is mass in grams, CC is specific heat capacity, and ΔT\Delta T is the change in temperature. Examples of specific heat values include Gold (0.13Jg1C10.13\,J\,g^{-1}\,^\circ C^{-1}), Aluminium (0.905Jg1C10.905\,J\,g^{-1}\,^\circ C^{-1}), and Silver (0.240Jg1C10.240\,J\,g^{-1}\,^\circ C^{-1}).