Junior Intermediate Mathematics Comprehensive Study Guide (NARAYANA GROUP CDF MATERIAL)

Functions and Core Geometrical Concepts Related to Sets A set is defined as a well-defined collection of objects. If A and B are non-empty sets, their Cartesian product, denoted as A×BA \times B (read as A cross B), consists of the set of all ordered pairs (a,b)(a,b) such that aAa \in A and bBb \in B. A relation is any subset of this Cartesian product. A function f:ABf: A \rightarrow B is a specific type of relation that associates every element in the domain A to a unique element in the co-domain B. If f(a)=bf(a) = b, then bb is the image of aa, and aa is the pre-image of bb. The range of as function is the subset of co-domain B containing all images of elements in A, expressed as Range={f(a):aA}Range = \{f(a) : a \in A\}. A function is an injection (one-one) if f(a1)=f(a2)f(a_1) = f(a_2) implies a1=a2a_1 = a_2. It is a surjection (onto) if every element in the co-domain B has at least one pre-image in A (meaning the range equals the co-domain). A bijection is a function that is both one-one and onto. Two functions ff and gg are equal (f=gf = g) if they share the same domain and f(x)=g(x)f(x) = g(x) for all xx in that domain. A constant function is defined as f(x)=cf(x) = c for all xx, while an identity function IAI_A maps every element to itself (f(x)=xf(x) = x). If a function is a bijection, its inverse f1:BAf^{-1}: B \rightarrow A exists such that f1(b)=af^{-1}(b) = a if and only if f(a)=bf(a) = b. The composition of functions f:ABf: A \rightarrow B and g:BCg: B \rightarrow C is denoted gf:ACg \circ f: A \rightarrow C where (gf)(a)=g(f(a))(g \circ f)(a) = g(f(a)). A function is even if f(x)=f(x)f(-x) = f(x) and odd if f(x)=f(x)f(-x) = -f(x). Special algebraic functions include the greatest integer function [x][x] (the largest integer less than or equal to xx), the modulus function x|x| (defined as xx for x0x \ge 0 and x-x for x<0x < 0), and the signum function sgn(x)sgn(x) (which returns 11 for x>0x > 0, 00 for x=0x = 0, and 1-1 for x<0x < 0). Algebraically, (f±g)(x)=f(x)±g(x)(f \pm g)(x) = f(x) \pm g(x), (fg)(x)=f(x)g(x)(fg)(x) = f(x)g(x), and (f/g)(x)=f(x)/g(x)(f/g)(x) = f(x)/g(x) provided g(x)0g(x) \neq 0. # Mathematical Induction and Series Summations The principle of mathematical induction involves three stages: the Basis of Induction (showing P(1)P(1) is true), the Inductive Hypothesis (assuming P(k)P(k) is true for k1k \ge 1), and the Inductive Step (proving P(k+1)P(k+1) is true). Fundamental summation formulas include the sum of the first nn natural numbers n=n(n+1)2\sum n = \frac{n(n+1)}{2}, the sum of their squares n2=n(n+1)(2n+1)6\sum n^2 = \frac{n(n+1)(2n+1)}{6}, and the sum of their cubes n3=n2(n+1)24\sum n^3 = \frac{n^2(n+1)^2}{4}. The sum of the first nn odd integers is 1+3+5+...+(2n1)=n21+3+5+...+(2n-1) = n^2, while the sum of the first nn even integers is 2+4+6+...+2n=n(n+1)2+4+6+...+2n = n(n+1). In an Arithmetic Progression (A.P.) with first term aa and common difference dd, the nthn^{th} term is tn=a+(n1)dt_n = a + (n-1)d and the sum of the first nn terms is Sn=n2[2a+(n1)d]S_n = \frac{n}{2}[2a + (n-1)d]. In a Geometric Progression (G.P.) with first term aa and common ratio rr, the nthn^{th} term is tn=a.rn1t_n = a.r^{n-1}. The sum Sn=a(rn1)r1S_n = \frac{a(r^n - 1)}{r - 1} for r>1r > 1, and the sum to infinity for r<1|r| < 1 is S=a1rS_{\infty} = \frac{a}{1 - r}. # Matrices and Determinants A matrix is an ordered rectangular array of elements. A matrix with mm rows and nn columns has order m×nm \times n. The trace of a square matrix, Tr(A)Tr(A), is the sum of its principal diagonal elements: a11+a22+a33a_{11} + a_{22} + a_{33}. Types of matrices include the diagonal matrix (non-diagonal elements are zero), scalar matrix (diagonal matrix with equal diagonal elements), and unit/identity matrix (diagonal elements are all 11). Triangular matrices are classified as upper (elements below the diagonal are zero, aij=0a_{ij} = 0 for i>ji > j) or lower (elements above the diagonal are zero, aij=0a_{ij} = 0 for i<ji < j). Two matrices are equal if they have the same order and identical corresponding elements. Matrix transpose ATA^T is formed by swapping rows and columns. A matrix is symmetric if AT=AA^T = A and skew-symmetric if AT=AA^T = -A (where diagonal elements must be zero). Determinants distinguish singular matrices (A=0|A| = 0) from non-singular ones (A0|A| \neq 0). The rank of a matrix is the maximum order of its non-singular square sub-matrices. Linear systems can be solved using Cramer's Rule where x=Δ1Δx = \frac{\Delta_1}{\Delta}, y=Δ2Δy = \frac{\Delta_2}{\Delta}, and z=Δ3Δz = \frac{\Delta_3}{\Delta}, or via the Matrix Inversion Method (X=A1DX = A^{-1}D). The Adjoint of a matrix is the transpose of its cofactor matrix, and the inverse is calculated as A1=AdjAAA^{-1} = \frac{Adj A}{|A|}. A system is consistent if it has solutions and inconsistent otherwise. # Vector Algebra and Product of Vectors A vector is a directed line segment with magnitude and direction. Two vectors are collinear if a=tba = tb for some scalar tt. The modulus of a vector r=xi+yj+zkr = xi + yj + zk is r=x2+y2+z2|r| = \sqrt{x^2 + y^2 + z^2}. Direction cosines are defined as cos(α)=xr\cos(\alpha) = \frac{x}{|r|}, cos(β)=yr\cos(\beta) = \frac{y}{|r|}, and cos(γ)=zr\cos(\gamma) = \frac{z}{|r|}. The internal section formula for a point P dividing the segment AB in ratio m:nm:n is P=mb+nam+nP = \frac{mb + na}{m + n}. The vector equation of a line through point aa parallel to bb is r=a+tbr = a + tb. The scalar (dot) product is defined as ab=abcos(θ)a \cdot b = |a||b|\cos(\theta), and vectors are perpendicular if ab=0a \cdot b = 0. The vector (cross) product is a×b=absin(θ)na \times b = |a||b|\sin(\theta)n, where nn is a unit vector perpendicular to both. The area of a triangle with adjacent sides ABAB and ACAC is 12AB×AC\frac{1}{2}|AB \times AC|. Scalar triple product [abc][a b c] results in the volume of a parallelepiped, while the volume of a tetrahedron is 16[abc]\frac{1}{6}|[a b c]| for co-terminous edges. The shortest distance between skew lines is given by (ac)(b×d)b×d\frac{|(a-c) \cdot (b \times d)|}{|b \times d|}. # Trigonometric Ratios and Transformations Standard trigonometric ratios for an angle θ\theta are sin(θ)=OppHyp\sin(\theta) = \frac{Opp}{Hyp}, cos(θ)=AdjHyp\cos(\theta) = \frac{Adj}{Hyp}, and tan(θ)=OppAdj\tan(\theta) = \frac{Opp}{Adj}. Fundamental identities include sin2(θ)+cos2(θ)=1\sin^2(\theta) + \cos^2(\theta) = 1, sec2(θ)tan2(θ)=1\sec^2(\theta) - \tan^2(\theta) = 1, and csc2(θ)cot2(θ)=1\csc^2(\theta) - \cot^2(\theta) = 1. Trigonometric values undergo sign changes based on quadrants (Q1,Q2,Q3,Q4Q_1, Q_2, Q_3, Q_4): all are positive in Q1Q_1, sine/cosecant in Q2Q_2, tangent/cotangent in Q3Q_3, and cosine/secant in Q4Q_4. For angles involving multiples of 9090^{\circ}, functions change (sine to cosine, etc.), whereas they remain the same for 180180^{\circ} multiples. The range of acos(x)+bsin(x)+ca \cos(x) + b \sin(x) + c is [ca2+b2,c+a2+b2][c - \sqrt{a^2+b^2}, c + \sqrt{a^2+b^2}]. Compound angle formulas include sin(A±B)=sin(A)cos(B)±cos(A)sin(B)\sin(A \pm B) = \sin(A)\cos(B) \pm \cos(A)\sin(B) and cos(A±B)=cos(A)cos(B)sin(A)sin(B)\cos(A \pm B) = \cos(A)\cos(B) \mp \sin(A)\sin(B). Multiple angle formulas such as sin(2A)=2sin(A)cos(A)\sin(2A) = 2\sin(A)\cos(A) and cos(2A)=cos2(A)sin2(A)=2cos2(A)1\cos(2A) = \cos^2(A) - \sin^2(A) = 2\cos^2(A) - 1 are central. Transformation formulas convert sums to products: sin(C)+sin(D)=2sin(C+D2)cos(CD2)\sin(C) + \sin(D) = 2\sin(\frac{C+D}{2})\cos(\frac{C-D}{2}) and cos(C)cos(D)=2sin(C+D2)sin(CD2)\cos(C) - \cos(D) = -2\sin(\frac{C+D}{2})\sin(\frac{C-D}{2}). General solutions for equations like sin(θ)=sin(α)\sin(\theta) = \sin(\alpha) are θ=nπ+(1)nα\theta = n\pi + (-1)^n\alpha. # Hyperbolic and Inverse Trigonometric Functions Hyperbolic functions are defined using exponentials: sinh(x)=exex2\sinh(x) = \frac{e^x - e^{-x}}{2} and cosh(x)=ex+ex2\cosh(x) = \frac{e^x + e^{-x}}{2}. They follow identities similar to circular functions, such as cosh2(x)sinh2(x)=1\cosh^2(x) - \sinh^2(x) = 1. Inverse hyperbolic functions are expressed logarithmically: sinh1(x)=log(x+x2+1)\sinh^{-1}(x) = \log(x + \sqrt{x^2 + 1}) and cosh1(x)=log(x+x21)\cosh^{-1}(x) = \log(x + \sqrt{x^2 - 1}). Inverse trigonometric functions like sin1(x)\sin^{-1}(x) have specific domains and ranges: sin1(x)+cos1(x)=π2\sin^{-1}(x) + \cos^{-1}(x) = \frac{\pi}{2} for x[1,1]x \in [-1, 1]. Sum and difference formulas for tan1\tan^{-1} vary depending on the product of variables (e.g., tan1(x)+tan1(y)=tan1(x+y1xy)\tan^{-1}(x) + \tan^{-1}(y) = \tan^{-1}(\frac{x+y}{1-xy}) if xy<1xy < 1). # Properties of Triangles In any triangle ABC with sides a,b,ca, b, c and semi-perimeter s=a+b+c2s = \frac{a+b+c}{2}, the Sine Rule states asin(A)=bsin(B)=csin(C)=2R\frac{a}{\sin(A)} = \frac{b}{\sin(B)} = \frac{c}{\sin(C)} = 2R, where RR is the circumradius. The Cosine Rule provides expressions like a2=b2+c22bccos(A)a^2 = b^2 + c^2 - 2bc \cos(A). Projection rules state a=bcos(C)+ccos(B)a = b \cos(C) + c \cos(B). The area Δ\Delta of a triangle can be calculated via s(sa)(sb)(sc)\sqrt{s(s-a)(s-b)(s-c)}, abc4R\frac{abc}{4R}, or rsrs (where rr is in-radius). Half-angle formulas provide sin(A2)=(sb)(sc)bc\sin(\frac{A}{2}) = \sqrt{\frac{(s-b)(s-c)}{bc}} and tan(A2)=(sb)(sc)s(sa)\tan(\frac{A}{2}) = \sqrt{\frac{(s-b)(s-c)}{s(s-a)}}. The in-radius r=4Rsin(A2)sin(B2)sin(C2)r = 4R \sin(\frac{A}{2}) \sin(\frac{B}{2}) \sin(\frac{C}{2}). Length of the median through A is 122b2+2c2a2\frac{1}{2}\sqrt{2b^2 + 2c^2 - a^2}. # Coordinate Geometry (2D and 3D) In 2D plane coordinate geometry, distance between points is (x2x1)2+(y2y1)2\sqrt{(x_2-x_1)^2 + (y_2-y_1)^2}. The centroid of a triangle is (xi3,yi3)(\frac{\sum x_i}{3}, \frac{\sum y_i}{3}). Important points of concurrency include the In-center (distance rr from sides), Orthocenter (intersection of altitudes), and Circumcenter (equidistant from vertices). A locus is a set of points satisfying specific geometric conditions. Shifting the origin to (h,k)(h,k) is a translation where x=X+hx = X+h; rotation through angle θ\theta transforms coordinates as X=xcos(θ)+ysin(θ)X = x\cos(\theta) + y\sin(\theta) and Y=xsin(θ)+ycos(θ)Y = -x\sin(\theta) + y\cos(\theta). Straight lines can be represented in various forms: Slope-intercept (y=mx+cy = mx+c), Intercept (xa+yb=1\frac{x}{a} + \frac{y}{b} = 1), and Normal (xcos(α)+ysin(α)=px\cos(\alpha) + y\sin(\alpha) = p). The distance from a point to a line ax+by+c=0ax+by+c=0 is ax1+by1+ca2+b2\frac{|ax_1+by_1+c|}{\sqrt{a^2+b^2}}. For 3D geometry, the distance of point P from axes involves square roots of sums of squares (e.g., from x-axis: y2+z2\sqrt{y^2+z^2}). Any line in 3D has direction cosines (l,m,n)(l, m, n) where l2+m2+n2=1l^2+m^2+n^2=1. The equation of a plane through (x1,y1,z1)(x_1, y_1, z_1) with normal d.r.'s (a,b,c)(a, b, c) is a(xx1)+b(yy1)+c(zz1)=0a(x-x_1) + b(y-y_1) + c(z-z_1) = 0. # Calculus: Limits, Continuity, and Differentiation The limit of function f(x)f(x) as xax \rightarrow a exists if the left-hand and right-hand limits are equal. Standard limits include limx0sin(x)x=1\lim_{x \rightarrow 0} \frac{\sin(x)}{x} = 1 and limxaxnanxa=n.an1\lim_{x \rightarrow a} \frac{x^n - a^n}{x - a} = n.a^{n-1}. A function is continuous at aa if the limit at aa equals f(a)f(a). Differentiation follows the First Principle: f(x)=limh0f(x+h)f(x)hf'(x) = \lim_{h \rightarrow 0} \frac{f(x+h) - f(x)}{h}. Basic derivatives include ddx(xn)=nxn1\frac{d}{dx}(x^n) = nx^{n-1}, ddx(sin(x))=cos(x)\frac{d}{dx}(\sin(x)) = \cos(x), ddx(ex)=ex\frac{d}{dx}(e^x) = e^x. Composite functions are differentiated via the chain rule: (fg)(x)=f(g(x))g(x)(f \circ g)'(x) = f'(g(x))g'(x). Applications include finding equations of tangents (yy1=m(xx1)y-y_1 = m(x-x_1)) and normals (yy1=1m(xx1)y-y_1 = -\frac{1}{m}(x-x_1)). Lengths of tangent, normal, sub-tangent, and sub-normal are specifically defined using the slope mm. Rolle's Theorem and Lagrange's Mean Value Theorem (LMVT) provide existence conditions for points where a derivative equals zero or an average slope. Functions are strictly increasing if f(x)>0f'(x) > 0 and decreasing if f(x)<0f'(x) < 0. Extremum values (maxima/minima) are identified through stationary points (f(x)=0f'(x) = 0) and checked using the second derivative test (f(c)<0f''(c) < 0 for maximum, f(c)>0f''(c) > 0 for minimum).