Module 7: Population Models and Community Principles

Foundations of Population Ecology and Influencing Factors

Population ecology is categorized as the meticulous study of the structure and size of populations. Within this field, structure is contextualized differently depending on the subjects: in humans, it correlates strictly with demography (e.g., biological sex), whereas in microbes, it relates to the specific strain, differentiation, or different life stages, such as whether a microorganism like Bacillus or Clostridium is in a spore-forming stage. Population ecology also encompasses population growth and population dynamics. The size of a population is fundamentally determined by four primary factors: the intrinsic growth rate (representing how fast a microorganism grows), mortality (death resulting from causes such as predators or parasites), immigration (incoming individuals), and emigration (outgoing individuals).

Furthermore, population growth rate is governed by abiotic and biotic factors. Abiotic factors include climate, weather conditions, nutrient availability, and pH levels. Biotic factors are split into intra-specific and inter-specific categories. Intra-specific factors involve interactions within the same species, such as competition or cooperation (exemplified by the quorum sensing mechanisms of myxomycetes). Inter-specific factors involve interactions between different species, which include competition, amensalism (such as the production of antibiotics or acids), predation, parasitism, commensalism, synergism (mutual benefits without species specificity), and mutualism.

Population Growth Models: Exponential and Logistic

The exponential growth model describes growth where the rate becomes ever more rapid in proportion to the total size or number of individuals. This model is characterized by a J-shaped growth curve but relies on several strict assumptions that are rarely met in the natural world: continuous reproduction with no seasonality, a lack of age structure where all organisms are identical, and an environment that is constant in space and time with unlimited resources.

In contrast, the logistic growth model, formulated by Pierre Verhulst in 1838, recognizes that natural populations may be limited by density. At low densities where N0N \ll 0 (as noted in provided materials), the population growth rate is maximal due to the absence of competition. However, the growth rate declines as the population number, represented by NN, increases. The growth rate eventually reaches zero when N=KN = K. The variable KK represents the upper limit of population growth, known as the carrying capacity, defined as the number of individuals of a population that can be sustained indefinitely by a given area. Natural populations may or may not conform strictly to this sigmoid growth curve.

Theory of r and K Population Selection

Developed by R.H. MacArthur and E.O. Wilson in 1967, the theory of r and K selection suggests a trade-off between reproductive capacity and the conservation of resources. Organisms are classified based on their position on the sigmoid curve. When NN is near 00, the growth rate (rr) is high; when N=KN = K, the growth rate is low.

r-strategists favor high reproductive rates (rr) and low population densities. They dominate in high-resource situations and are described as opportunists characterized by "boom and bust" cycles. They often benefit from dormant stages and are referred to as "zymogenous," or fast growers. Specific examples include bloom-forming algae, Aspergillus, Penicillium, Pseudomonas, Bacillus, and various enteric bacteria.

K-strategists focus on physiological adaptation to the environment and the optimal use of resources. They reproduce more slowly and are highly successful in low-resource situations. They represent the permanent members of a community, often referred to as "autochthonous" (humus-degrading) organisms. Examples of K-strategists include Desmids, Caulobacter, Actinomyces, and cellulose-degrading Basidiomycota.

Microbial Biofilms: Structure, Formation, and Implications

Most microbes in nature grow attached to surfaces (sessile) rather than as free-floating (planktonic) cells. These surface-attached communities, enclosed in a slime of microbial origin, are known as biofilms. Biofilms can be composed of single or multiple species, forming complex three-dimensional structures that are ubiquitous in nature and can form on any conditioned surface.

Biofilm formation begins when microbes reversibly attach to a conditioned surface and release the extracellular polymeric substance (EPS), comprised of polysaccharides, proteins, and DNA. As the microbes reproduce and the biofilm matures, additional polymers are produced. This process is regulated by quorum sensing, which utilizes chemical signaling molecules called autoinducers to trigger gene expression, specifically turning on polysaccharide-producing genes. This is an energy-intensive process requiring significant ATP because polymer creation involves anabolism.

Living within a biofilm provides several advantages: self-defense against phagocytosis and toxic compounds, retention in favorable ecological spaces, and enhanced close associations that facilitate nutrient and genetic exchange. Structurally, biofilms exhibit metabolic heterogeneity; cells on the periphery receive more nutrients than those in the center. However, biofilms present significant problems. In health, they are associated with periodontal disease, chronic wounds, kidney stones, tuberculosis, and cystic fibrosis, as well as contamination of implants. In industry, they can corrode metal surfaces, slow the flow of liquids in pipelines, and resist chlorination in water systems. Current drug development efforts are focused on identifying antibiotics that can disrupt these biofilm structures.

Community Ecology and Successional Mechanisms

Ecological organization follows a hierarchy: Individual (\rightarrow) Population (\rightarrow) Guild (\rightarrow) Community (\rightarrow) Ecosystem. Autecology focused on population ecology (single species), while synecology focuses on community ecology (groups of populations). A guild refers to a functional group of organisms using the same resources.

Succession is defined by F.E. Clements (1916) as a continuous directional change in species composition through extinction and colonization, leading to a single, ultimate climax community. Michael Huston and Thomas Smith (1987) defined it as a sequential change in the relative abundances of dominant species following a disturbance. Primary succession occurs on newly exposed land, such as retreating glaciers, lava flows, or weathered rock (bare rock). Secondary succession occurs on newly disturbed land with remaining remnant populations, such as areas affected by forest fires or agriculture.

Succession is also categorized by its energy dynamics. Autotrophic succession, seen in Winogradsky columns or lichens on volcanic rock, occurs when gross production (PP) exceeds community respiration (RR) (P>RP > R), leading to organic matter accumulation. Stability is reached when PR1\frac{P}{R} \approx 1. Heterotrophic succession, seen in hay infusions or fallen logs, occurs when gross production is less than respiration (P<RP < R), meaning the energy supply decreases over time; this is usually a temporary state.

Joseph Connell and Ralph Slatyer (1977) proposed three mechanisms of succession in vegetation:

  1. Facilitation: Early species make the environment more suitable for successive species (highly relevant to Winogradsky columns).
  2. Tolerance: Early species neither hinder nor help late species; late species invade due to their ability to tolerate lower resource levels.
  3. Inhibition: Early species hold the site against all invaders until a disturbance creates space for newcomers.

Species Diversity and Mathematical Indices

Species diversity includes the measurement of the number of species (richness) and the abundance of each species (evenness). In microbiology, strains belong to the same species if they share >97%> 97\% similarity in 16S rRNA gene sequences and >70%> 70\% similarity in DNA-DNA hybridization. Diversity can be measured at different scales:

Alpha Diversity refers to "within-sample" diversity. A common measure is the Shannon Index (or Shannon-Weaver/Shannon-Wiener index), which weights richness significantly. It measures the uncertainty (entropy) of predicting the next species in a sample. The formula is: Shannon=i=1Rpiln(pi)Shannon = - \sum_{i=1}^{R} p_i \ln(p_i) where pip_i is the proportion of observations for the i-thi\text{-th} species. For example, sample A has a Shannon index of 1.0051.005, sample B has 1.6061.606, and sample C has 1.2121.212.

Beta Diversity measures how two samples differ (dissimilarity). The Bray-Curtis Dissimilarity index is frequently used. It ranges from 00 (identical) to 11 (completely different). The formula is: BCij=12CijSi+SjBC_{ij} = 1 - \frac{2C_{ij}}{S_i + S_j} where CijC_{ij} is the sum of the lesser values for species in common, and SiS_i and SjS_j are total microbe counts. Given an example where Cij=13C_{ij} = 13, Si=22S_i = 22, and Sj=24S_j = 24, the calculation is: BC=12×1322+24=12646=0.4348BC = 1 - \frac{2 \times 13}{22 + 24} = 1 - \frac{26}{46} = 0.4348

Factors Influencing Diversity and Stability

Diversity is generally low in physically-controlled environments, such as hot springs, and high in biologically-controlled systems, like soil, where interactions are more critical than abiotic factors. Factors giving rise to diversity include habitat complexity, resource multiplicity, temporal heterogeneity, interactions (e.g., leguminous trees interacting with nitrogen fixers in the Amazon), and evolution.

Joseph Connell (1978) proposed the Intermediate Disturbance Hypothesis, which suggests that the highest local diversities are maintained at intermediate levels of disturbance. Low disturbance allows for a few species to achieve dominance, while high disturbance prevents most species from establishing. Principal Coordinates Analysis (PCoA) plots using Bray-Curtis distances are used to visualize these differences, showing clustering of microbial communities in different environments, such as soil, the rhizosphere, or infected rhizoendospheres.